C16H19N7O — CID 33011990
N-[(1R)-1-cyano-1-cyclopropylethyl]-2-[4-methyl-3-(tetrazol-1-yl)anilino]acetamide (PubChem CID 33011990) has the molecular formula C16H19N7O and a molecular weight of 325.38 g/mol. Its IUPAC name is N-[(1R)-1-cyano-1-cyclopropylethyl]-2-[4-methyl-3-(tetrazol-1-yl)anilino]acetamide.
| Compound Name | N-[(1R)-1-cyano-1-cyclopropylethyl]-2-[4-methyl-3-(tetrazol-1-yl)anilino]acetamide |
|---|---|
| PubChem CID | 33011990 |
| Molecular Formula | C16H19N7O |
| Molecular Weight | 325.38 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | N-[(1R)-1-cyano-1-cyclopropylethyl]-2-[4-methyl-3-(tetrazol-1-yl)anilino]acetamide |
| SMILES | Cc1ccc(NCC(=O)N[C@@](C)(C#N)C2CC2)cc1-n1cnnn1 |
| InChI | InChI=1S/C16H19N7O/c1-11-3-6-13(7-14(11)23-10-19-21-22-23)18-8-15(24)20-16(2,9-17)12-4-5-12/h3,6-7,10,12,18H,4-5,8H2,1-2H3,(H,20,24)/t16-/m0/s1 |
| InChIKey | YNKGKZKLSNTLDJ-INIZCTEOSA-N |
| XLogP | 1.19 |
| TPSA | 108.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.38 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |