C17H26N4S — CID 3301279
1-[[4-(2-methylbutan-2-yl)cyclohexylidene]amino]-3-pyridin-3-ylthiourea (PubChem CID 3301279) has the molecular formula C17H26N4S and a molecular weight of 318.49 g/mol. Its IUPAC name is 1-[[4-(2-methylbutan-2-yl)cyclohexylidene]amino]-3-pyridin-3-ylthiourea.
| Compound Name | 1-[[4-(2-methylbutan-2-yl)cyclohexylidene]amino]-3-pyridin-3-ylthiourea |
|---|---|
| PubChem CID | 3301279 |
| Molecular Formula | C17H26N4S |
| Molecular Weight | 318.49 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | 1-[[4-(2-methylbutan-2-yl)cyclohexylidene]amino]-3-pyridin-3-ylthiourea |
| SMILES | CCC(C)(C)C1CCC(=NNC(=S)Nc2cccnc2)CC1 |
| InChI | InChI=1S/C17H26N4S/c1-4-17(2,3)13-7-9-14(10-8-13)20-21-16(22)19-15-6-5-11-18-12-15/h5-6,11-13H,4,7-10H2,1-3H3,(H2,19,21,22)/b20-14- |
| InChIKey | ILRLMHZVQOFSEQ-ZHZULCJRSA-N |
| XLogP | 4.35 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.49 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|