C10H21BO2 — CID 3301663
2-tert-butyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 3301663) has the molecular formula C10H21BO2 and a molecular weight of 184.09 g/mol. Its IUPAC name is 2-tert-butyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-tert-butyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 3301663 |
| Molecular Formula | C10H21BO2 |
| Molecular Weight | 184.09 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | 2-tert-butyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC(C)(C)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C10H21BO2/c1-8(2,3)11-12-9(4,5)10(6,7)13-11/h1-7H3 |
| InChIKey | ZQEPUUOQJIWIFJ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.09 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|