C20H13ClN2O3 — CID 3301984
1-(4-chlorophenyl)-5-(2-hydroxy-5-methylbenzoyl)-2-oxopyridine-3-carbonitrile (PubChem CID 3301984) has the molecular formula C20H13ClN2O3 and a molecular weight of 364.79 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-5-(2-hydroxy-5-methylbenzoyl)-2-oxopyridine-3-carbonitrile.
| Compound Name | 1-(4-chlorophenyl)-5-(2-hydroxy-5-methylbenzoyl)-2-oxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 3301984 |
| Molecular Formula | C20H13ClN2O3 |
| Molecular Weight | 364.79 g/mol |
| Exact Mass | 364.06 |
| IUPAC Name | 1-(4-chlorophenyl)-5-(2-hydroxy-5-methylbenzoyl)-2-oxopyridine-3-carbonitrile |
| SMILES | Cc1ccc(O)c(C(=O)c2cc(C#N)c(=O)n(-c3ccc(Cl)cc3)c2)c1 |
| InChI | InChI=1S/C20H13ClN2O3/c1-12-2-7-18(24)17(8-12)19(25)14-9-13(10-22)20(26)23(11-14)16-5-3-15(21)4-6-16/h2-9,11,24H,1H3 |
| InChIKey | ZARPCUZJHDFBAT-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.79 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |