C20H22N2O4S — CID 3302786
1-[4-(benzenesulfonyl)piperazin-1-yl]-3-(3-methoxyphenyl)prop-2-en-1-one (PubChem CID 3302786) has the molecular formula C20H22N2O4S and a molecular weight of 386.47 g/mol. Its IUPAC name is 1-[4-(benzenesulfonyl)piperazin-1-yl]-3-(3-methoxyphenyl)prop-2-en-1-one.
| Compound Name | 1-[4-(benzenesulfonyl)piperazin-1-yl]-3-(3-methoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 3302786 |
| Molecular Formula | C20H22N2O4S |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | 1-[4-(benzenesulfonyl)piperazin-1-yl]-3-(3-methoxyphenyl)prop-2-en-1-one |
| SMILES | COc1cccc(C=CC(=O)N2CCN(S(=O)(=O)c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C20H22N2O4S/c1-26-18-7-5-6-17(16-18)10-11-20(23)21-12-14-22(15-13-21)27(24,25)19-8-3-2-4-9-19/h2-11,16H,12-15H2,1H3 |
| InChIKey | QGNKCTSJFHPZSS-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|