About Isoxazolo(3,4-d)pyridazin-7(6H)-one, 4,6-diphenyl-3-methyl-
Isoxazolo(3,4-d)pyridazin-7(6H)-one, 4,6-diphenyl-3-methyl- (PubChem CID 33028) has the molecular formula C18H13N3O2
and a molecular weight of 303.30 g/mol. Its IUPAC name is 3-methyl-4,6-diphenyl-[1,2]oxazolo[3,4-d]pyridazin-7-one.
Molecular Properties
| Compound Name | Isoxazolo(3,4-d)pyridazin-7(6H)-one, 4,6-diphenyl-3-methyl- |
| PubChem CID | 33028 |
| Molecular Formula | C18H13N3O2 |
| Molecular Weight | 303.30 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | 3-methyl-4,6-diphenyl-[1,2]oxazolo[3,4-d]pyridazin-7-one |
| SMILES | CC1=C2C(=NN(C(=O)C2=NO1)C3=CC=CC=C3)C4=CC=CC=C4 |
| InChI | InChI=1S/C18H13N3O2/c1-12-15-16(13-8-4-2-5-9-13)19-21(14-10-6-3-7-11-14)18(22)17(15)20-23-12/h2-11H,1H3 |
| InChIKey | JXQJWJVSXBROGH-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 58.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | 481 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.30 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze Isoxazolo(3,4-d)pyridazin-7(6H)-one, 4,6-diphenyl-3-methyl- with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Isoxazolo(3,4-d)pyridazin-7(6H)-one, 4,6-diphenyl-3-methyl-?
The IUPAC name of Isoxazolo(3,4-d)pyridazin-7(6H)-one, 4,6-diphenyl-3-methyl- (CID 33028) is 3-methyl-4,6-diphenyl-[1,2]oxazolo[3,4-d]pyridazin-7-one.
What is the SMILES notation for Isoxazolo(3,4-d)pyridazin-7(6H)-one, 4,6-diphenyl-3-methyl-?
The canonical SMILES for Isoxazolo(3,4-d)pyridazin-7(6H)-one, 4,6-diphenyl-3-methyl- is CC1=C2C(=NN(C(=O)C2=NO1)C3=CC=CC=C3)C4=CC=CC=C4.
What is the InChIKey of Isoxazolo(3,4-d)pyridazin-7(6H)-one, 4,6-diphenyl-3-methyl-?
The InChIKey is JXQJWJVSXBROGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13N3O2/c1-12-15-16(13-8-4-2-5-9-13)19-21(14-10-6-3-7-11-14)18(22)17(15)20-23-12/h2-11H,1H3.
What are the key properties of Isoxazolo(3,4-d)pyridazin-7(6H)-one, 4,6-diphenyl-3-methyl-?
Isoxazolo(3,4-d)pyridazin-7(6H)-one, 4,6-diphenyl-3-methyl- has a molecular weight of 303.30 g/mol, XLogP of 3.60, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for Isoxazolo(3,4-d)pyridazin-7(6H)-one, 4,6-diphenyl-3-methyl- is sourced from PubChem (CID 33028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).