C5H7N5O — CID 3303015
2-amino-1,4,5,7-tetrahydropurin-6-one (PubChem CID 3303015) has the molecular formula C5H7N5O and a molecular weight of 153.14 g/mol. Its IUPAC name is 2-amino-1,4,5,7-tetrahydropurin-6-one.
| Compound Name | 2-amino-1,4,5,7-tetrahydropurin-6-one |
|---|---|
| PubChem CID | 3303015 |
| Molecular Formula | C5H7N5O |
| Molecular Weight | 153.14 g/mol |
| Exact Mass | 153.07 |
| IUPAC Name | 2-amino-1,4,5,7-tetrahydropurin-6-one |
| SMILES | NC1=NC2N=CNC2C(=O)N1 |
| InChI | InChI=1S/C5H7N5O/c6-5-9-3-2(4(11)10-5)7-1-8-3/h1-3H,(H,7,8)(H3,6,9,10,11) |
| InChIKey | ORSFRSRYZSZSIU-UHFFFAOYSA-N |
| XLogP | -2.24 |
| TPSA | 91.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.14 |
| LogP ≤ 5 | -2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |