C46H50F3NO6 — CID 3303248
ethyl N-[[5,13-dihydroxy-6,10-dimethyl-17-(2-phenylbenzoyl)-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-N-[[4-(trifluoromethoxy)phenyl]methyl]carbamate (PubChem CID 3303248) has the molecular formula C46H50F3NO6 and a molecular weight of 769.90 g/mol. Its IUPAC name is ethyl N-[[5,13-dihydroxy-6,10-dimethyl-17-(2-phenylbenzoyl)-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-N-[[4-(trifluoromethoxy)phenyl]methyl]carbamate.
| Compound Name | ethyl N-[[5,13-dihydroxy-6,10-dimethyl-17-(2-phenylbenzoyl)-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-N-[[4-(trifluoromethoxy)phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 3303248 |
| Molecular Formula | C46H50F3NO6 |
| Molecular Weight | 769.90 g/mol |
| Exact Mass | 769.36 |
| IUPAC Name | ethyl N-[[5,13-dihydroxy-6,10-dimethyl-17-(2-phenylbenzoyl)-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-N-[[4-(trifluoromethoxy)phenyl]methyl]carbamate |
| SMILES | CCOC(=O)N(Cc1ccc(OC(F)(F)F)cc1)CC1(O)CCC2C34C=CC5(C=C3C(=O)c3ccccc3-c3ccccc3)CC(O)CCC5(C)C4CCC21C |
| InChI | InChI=1S/C46H50F3NO6/c1-4-55-40(53)50(28-30-14-16-33(17-15-30)56-46(47,48)49)29-44(54)23-20-38-42(44,3)22-19-37-41(2)21-18-32(51)26-43(41)24-25-45(37,38)36(27-43)39(52)35-13-9-8-12-34(35)31-10-6-5-7-11-31/h5-17,24-25,27,32,37-38,51,54H,4,18-23,26,28-29H2,1-3H3 |
| InChIKey | HXTJDSBVDYWGFZ-UHFFFAOYSA-N |
| XLogP | 9.68 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 769.90 |
| LogP ≤ 5 | 9.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|