C17H13FN4O2S — CID 3304343
ethyl 4-(3-fluorophenyl)-12-methyl-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene-11-carboxylate (PubChem CID 3304343) has the molecular formula C17H13FN4O2S and a molecular weight of 356.38 g/mol. Its IUPAC name is ethyl 4-(3-fluorophenyl)-12-methyl-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene-11-carboxylate.
| Compound Name | ethyl 4-(3-fluorophenyl)-12-methyl-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene-11-carboxylate |
|---|---|
| PubChem CID | 3304343 |
| Molecular Formula | C17H13FN4O2S |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | ethyl 4-(3-fluorophenyl)-12-methyl-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene-11-carboxylate |
| SMILES | CCOC(=O)c1sc2ncn3nc(-c4cccc(F)c4)nc3c2c1C |
| InChI | InChI=1S/C17H13FN4O2S/c1-3-24-17(23)13-9(2)12-15-20-14(10-5-4-6-11(18)7-10)21-22(15)8-19-16(12)25-13/h4-8H,3H2,1-2H3 |
| InChIKey | CUKIVTVIVHBCMW-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 69.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |