C24H23Cl3N2O4 — CID 3304648
(4-chlorophenyl)-[2-(2,4-dichlorophenyl)-1-(3-morpholin-4-ium-4-ylpropyl)-4,5-dioxopyrrolidin-3-ylidene]methanolate (PubChem CID 3304648) has the molecular formula C24H23Cl3N2O4 and a molecular weight of 509.82 g/mol. Its IUPAC name is (4-chlorophenyl)-[2-(2,4-dichlorophenyl)-1-(3-morpholin-4-ium-4-ylpropyl)-4,5-dioxopyrrolidin-3-ylidene]methanolate.
| Compound Name | (4-chlorophenyl)-[2-(2,4-dichlorophenyl)-1-(3-morpholin-4-ium-4-ylpropyl)-4,5-dioxopyrrolidin-3-ylidene]methanolate |
|---|---|
| PubChem CID | 3304648 |
| Molecular Formula | C24H23Cl3N2O4 |
| Molecular Weight | 509.82 g/mol |
| Exact Mass | 508.07 |
| IUPAC Name | (4-chlorophenyl)-[2-(2,4-dichlorophenyl)-1-(3-morpholin-4-ium-4-ylpropyl)-4,5-dioxopyrrolidin-3-ylidene]methanolate |
| SMILES | O=C1C(=O)N(CCC[NH+]2CCOCC2)C(c2ccc(Cl)cc2Cl)C1=C([O-])c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H23Cl3N2O4/c25-16-4-2-15(3-5-16)22(30)20-21(18-7-6-17(26)14-19(18)27)29(24(32)23(20)31)9-1-8-28-10-12-33-13-11-28/h2-7,14,21,30H,1,8-13H2 |
| InChIKey | SVTURORWDXSSSB-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 74.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.82 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|