C22H22N2O4S — CID 3305303
4-but-3-enoxy-N-(2-methylquinolin-6-yl)-N-methylsulfonylbenzamide (PubChem CID 3305303) has the molecular formula C22H22N2O4S and a molecular weight of 410.50 g/mol. Its IUPAC name is 4-but-3-enoxy-N-(2-methylquinolin-6-yl)-N-methylsulfonylbenzamide.
| Compound Name | 4-but-3-enoxy-N-(2-methylquinolin-6-yl)-N-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 3305303 |
| Molecular Formula | C22H22N2O4S |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | 4-but-3-enoxy-N-(2-methylquinolin-6-yl)-N-methylsulfonylbenzamide |
| SMILES | C=CCCOc1ccc(C(=O)N(c2ccc3nc(C)ccc3c2)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C22H22N2O4S/c1-4-5-14-28-20-11-8-17(9-12-20)22(25)24(29(3,26)27)19-10-13-21-18(15-19)7-6-16(2)23-21/h4,6-13,15H,1,5,14H2,2-3H3 |
| InChIKey | XAZJHPRXYJMTMR-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|