C10H7Cl5O — CID 3305421
1,2,3,4,5-pentachloro-6-(2-methylprop-2-enoxy)benzene (PubChem CID 3305421) has the molecular formula C10H7Cl5O and a molecular weight of 320.43 g/mol. Its IUPAC name is 1,2,3,4,5-pentachloro-6-(2-methylprop-2-enoxy)benzene.
| Compound Name | 1,2,3,4,5-pentachloro-6-(2-methylprop-2-enoxy)benzene |
|---|---|
| PubChem CID | 3305421 |
| Molecular Formula | C10H7Cl5O |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 317.89 |
| IUPAC Name | 1,2,3,4,5-pentachloro-6-(2-methylprop-2-enoxy)benzene |
| SMILES | C=C(C)COc1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C10H7Cl5O/c1-4(2)3-16-10-8(14)6(12)5(11)7(13)9(10)15/h1,3H2,2H3 |
| InChIKey | UWFALNMGNVPONP-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|