C37H49ClFNO6 — CID 3305800
ethyl N-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-(3-methoxypropyl)carbamate (PubChem CID 3305800) has the molecular formula C37H49ClFNO6 and a molecular weight of 658.25 g/mol. Its IUPAC name is ethyl N-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-(3-methoxypropyl)carbamate.
| Compound Name | ethyl N-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-(3-methoxypropyl)carbamate |
|---|---|
| PubChem CID | 3305800 |
| Molecular Formula | C37H49ClFNO6 |
| Molecular Weight | 658.25 g/mol |
| Exact Mass | 657.32 |
| IUPAC Name | ethyl N-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-(3-methoxypropyl)carbamate |
| SMILES | CCOC(=O)N(CCCOC)CC1(O)CCC2c3ccc(cc3C(=O)Cc3c(F)cccc3Cl)CC(O)CCC(C)=CCCC21C |
| InChI | InChI=1S/C37H49ClFNO6/c1-5-46-35(43)40(19-8-20-45-4)24-37(44)18-16-31-28-15-13-26(21-27(41)14-12-25(2)9-7-17-36(31,37)3)22-29(28)34(42)23-30-32(38)10-6-11-33(30)39/h6,9-11,13,15,22,27,31,41,44H,5,7-8,12,14,16-21,23-24H2,1-4H3 |
| InChIKey | KAJYHAMRUUZKPT-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.25 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|