C21H29FN4O2 — CID 33071571
N-(1-cyanocyclohexyl)-2-[4-[(3-fluoro-4-methoxyphenyl)methyl]piperazin-1-yl]acetamide (PubChem CID 33071571) has the molecular formula C21H29FN4O2 and a molecular weight of 388.49 g/mol. Its IUPAC name is N-(1-cyanocyclohexyl)-2-[4-[(3-fluoro-4-methoxyphenyl)methyl]piperazin-1-yl]acetamide.
| Compound Name | N-(1-cyanocyclohexyl)-2-[4-[(3-fluoro-4-methoxyphenyl)methyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 33071571 |
| Molecular Formula | C21H29FN4O2 |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.23 |
| IUPAC Name | N-(1-cyanocyclohexyl)-2-[4-[(3-fluoro-4-methoxyphenyl)methyl]piperazin-1-yl]acetamide |
| SMILES | COc1ccc(CN2CCN(CC(=O)NC3(C#N)CCCCC3)CC2)cc1F |
| InChI | InChI=1S/C21H29FN4O2/c1-28-19-6-5-17(13-18(19)22)14-25-9-11-26(12-10-25)15-20(27)24-21(16-23)7-3-2-4-8-21/h5-6,13H,2-4,7-12,14-15H2,1H3,(H,24,27) |
| InChIKey | CSGVSVJKUMLNRP-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 68.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |