C9H8N6O4S — CID 3307746
1,3-bis(2,4-dioxo-1H-pyrimidin-5-yl)thiourea (PubChem CID 3307746) has the molecular formula C9H8N6O4S and a molecular weight of 296.27 g/mol. Its IUPAC name is 1,3-bis(2,4-dioxo-1H-pyrimidin-5-yl)thiourea.
| Compound Name | 1,3-bis(2,4-dioxo-1H-pyrimidin-5-yl)thiourea |
|---|---|
| PubChem CID | 3307746 |
| Molecular Formula | C9H8N6O4S |
| Molecular Weight | 296.27 g/mol |
| Exact Mass | 296.03 |
| IUPAC Name | 1,3-bis(2,4-dioxo-1H-pyrimidin-5-yl)thiourea |
| SMILES | O=c1[nH]cc(NC(=S)Nc2c[nH]c(=O)[nH]c2=O)c(=O)[nH]1 |
| InChI | InChI=1S/C9H8N6O4S/c16-5-3(1-10-7(18)14-5)12-9(20)13-4-2-11-8(19)15-6(4)17/h1-2H,(H2,12,13,20)(H2,10,14,16,18)(H2,11,15,17,19) |
| InChIKey | YPENQIUYDOYXEF-UHFFFAOYSA-N |
| XLogP | -1.75 |
| TPSA | 155.50 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.27 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|