C16H21N3O4 — CID 33082783
2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-(2-propoxyphenyl)acetamide (PubChem CID 33082783) has the molecular formula C16H21N3O4 and a molecular weight of 319.36 g/mol. Its IUPAC name is 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-(2-propoxyphenyl)acetamide.
| Compound Name | 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-(2-propoxyphenyl)acetamide |
|---|---|
| PubChem CID | 33082783 |
| Molecular Formula | C16H21N3O4 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-(2-propoxyphenyl)acetamide |
| SMILES | CCCOc1ccccc1NC(=O)CN1C(=O)NC(C)(C)C1=O |
| InChI | InChI=1S/C16H21N3O4/c1-4-9-23-12-8-6-5-7-11(12)17-13(20)10-19-14(21)16(2,3)18-15(19)22/h5-8H,4,9-10H2,1-3H3,(H,17,20)(H,18,22) |
| InChIKey | RVZURWKPJMJGHN-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|