C18H17ClFN3O2 — CID 33083968
N-(5-chloro-2-methoxyphenyl)-2-[(5-cyano-2-fluorophenyl)methyl-methylamino]acetamide (PubChem CID 33083968) has the molecular formula C18H17ClFN3O2 and a molecular weight of 361.80 g/mol. Its IUPAC name is N-(5-chloro-2-methoxyphenyl)-2-[(5-cyano-2-fluorophenyl)methyl-methylamino]acetamide.
| Compound Name | N-(5-chloro-2-methoxyphenyl)-2-[(5-cyano-2-fluorophenyl)methyl-methylamino]acetamide |
|---|---|
| PubChem CID | 33083968 |
| Molecular Formula | C18H17ClFN3O2 |
| Molecular Weight | 361.80 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | N-(5-chloro-2-methoxyphenyl)-2-[(5-cyano-2-fluorophenyl)methyl-methylamino]acetamide |
| SMILES | COc1ccc(Cl)cc1NC(=O)CN(C)Cc1cc(C#N)ccc1F |
| InChI | InChI=1S/C18H17ClFN3O2/c1-23(10-13-7-12(9-21)3-5-15(13)20)11-18(24)22-16-8-14(19)4-6-17(16)25-2/h3-8H,10-11H2,1-2H3,(H,22,24) |
| InChIKey | GUJPKMRNGFCHMG-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.80 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |