About 1,3-dibenzyl-2-(5-methylthiophen-2-yl)imidazolidine-1,3-diium
1,3-dibenzyl-2-(5-methylthiophen-2-yl)imidazolidine-1,3-diium (PubChem CID 3310157) has the molecular formula C22H26N2S+2
and a molecular weight of 350.53 g/mol. Its IUPAC name is 1,3-dibenzyl-2-(5-methylthiophen-2-yl)imidazolidine-1,3-diium.
Molecular Properties
| Compound Name | 1,3-dibenzyl-2-(5-methylthiophen-2-yl)imidazolidine-1,3-diium |
| PubChem CID | 3310157 |
| Molecular Formula | C22H26N2S+2 |
| Molecular Weight | 350.53 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | 1,3-dibenzyl-2-(5-methylthiophen-2-yl)imidazolidine-1,3-diium |
| SMILES | Cc1ccc(C2[NH+](Cc3ccccc3)CC[NH+]2Cc2ccccc2)s1 |
| InChI | InChI=1S/C22H24N2S/c1-18-12-13-21(25-18)22-23(16-19-8-4-2-5-9-19)14-15-24(22)17-20-10-6-3-7-11-20/h2-13,22H,14-17H2,1H3/p+2 |
| InChIKey | IYYJKTNSUICJAS-UHFFFAOYSA-P |
| XLogP | 2.24 |
| TPSA | 8.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.53 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,3-dibenzyl-2-(5-methylthiophen-2-yl)imidazolidine-1,3-diium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dibenzyl-2-(5-methylthiophen-2-yl)imidazolidine-1,3-diium?
The IUPAC name of 1,3-dibenzyl-2-(5-methylthiophen-2-yl)imidazolidine-1,3-diium (CID 3310157) is 1,3-dibenzyl-2-(5-methylthiophen-2-yl)imidazolidine-1,3-diium.
What is the SMILES notation for 1,3-dibenzyl-2-(5-methylthiophen-2-yl)imidazolidine-1,3-diium?
The canonical SMILES for 1,3-dibenzyl-2-(5-methylthiophen-2-yl)imidazolidine-1,3-diium is Cc1ccc(C2[NH+](Cc3ccccc3)CC[NH+]2Cc2ccccc2)s1.
What is the InChIKey of 1,3-dibenzyl-2-(5-methylthiophen-2-yl)imidazolidine-1,3-diium?
The InChIKey is IYYJKTNSUICJAS-UHFFFAOYSA-P. The full InChI is InChI=1S/C22H24N2S/c1-18-12-13-21(25-18)22-23(16-19-8-4-2-5-9-19)14-15-24(22)17-20-10-6-3-7-11-20/h2-13,22H,14-17H2,1H3/p+2.
What are the key properties of 1,3-dibenzyl-2-(5-methylthiophen-2-yl)imidazolidine-1,3-diium?
1,3-dibenzyl-2-(5-methylthiophen-2-yl)imidazolidine-1,3-diium has a molecular weight of 350.53 g/mol, XLogP of 2.24, 5 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dibenzyl-2-(5-methylthiophen-2-yl)imidazolidine-1,3-diium is sourced from PubChem (CID 3310157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).