About 1-[3-(2,5-dimethylphenoxy)propyl]-4-thiophen-2-yltetrazol-5-one
1-[3-(2,5-dimethylphenoxy)propyl]-4-thiophen-2-yltetrazol-5-one (PubChem CID 33110444) has the molecular formula C16H18N4O2S
and a molecular weight of 330.41 g/mol. Its IUPAC name is 1-[3-(2,5-dimethylphenoxy)propyl]-4-thiophen-2-yltetrazol-5-one.
Molecular Properties
| Compound Name | 1-[3-(2,5-dimethylphenoxy)propyl]-4-thiophen-2-yltetrazol-5-one |
| PubChem CID | 33110444 |
| Molecular Formula | C16H18N4O2S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 1-[3-(2,5-dimethylphenoxy)propyl]-4-thiophen-2-yltetrazol-5-one |
| SMILES | Cc1ccc(C)c(OCCCn2nnn(-c3cccs3)c2=O)c1 |
| InChI | InChI=1S/C16H18N4O2S/c1-12-6-7-13(2)14(11-12)22-9-4-8-19-16(21)20(18-17-19)15-5-3-10-23-15/h3,5-7,10-11H,4,8-9H2,1-2H3 |
| InChIKey | JSXLGSABZUUCQK-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 61.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[3-(2,5-dimethylphenoxy)propyl]-4-thiophen-2-yltetrazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(2,5-dimethylphenoxy)propyl]-4-thiophen-2-yltetrazol-5-one?
The IUPAC name of 1-[3-(2,5-dimethylphenoxy)propyl]-4-thiophen-2-yltetrazol-5-one (CID 33110444) is 1-[3-(2,5-dimethylphenoxy)propyl]-4-thiophen-2-yltetrazol-5-one.
What is the SMILES notation for 1-[3-(2,5-dimethylphenoxy)propyl]-4-thiophen-2-yltetrazol-5-one?
The canonical SMILES for 1-[3-(2,5-dimethylphenoxy)propyl]-4-thiophen-2-yltetrazol-5-one is Cc1ccc(C)c(OCCCn2nnn(-c3cccs3)c2=O)c1.
What is the InChIKey of 1-[3-(2,5-dimethylphenoxy)propyl]-4-thiophen-2-yltetrazol-5-one?
The InChIKey is JSXLGSABZUUCQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N4O2S/c1-12-6-7-13(2)14(11-12)22-9-4-8-19-16(21)20(18-17-19)15-5-3-10-23-15/h3,5-7,10-11H,4,8-9H2,1-2H3.
What are the key properties of 1-[3-(2,5-dimethylphenoxy)propyl]-4-thiophen-2-yltetrazol-5-one?
1-[3-(2,5-dimethylphenoxy)propyl]-4-thiophen-2-yltetrazol-5-one has a molecular weight of 330.41 g/mol, XLogP of 2.58, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(2,5-dimethylphenoxy)propyl]-4-thiophen-2-yltetrazol-5-one is sourced from PubChem (CID 33110444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).