C15H17N — CID 3311064
N,N,2-trimethyl-6-phenylhexa-3,5-diyn-2-amine (PubChem CID 3311064) has the molecular formula C15H17N and a molecular weight of 211.31 g/mol. Its IUPAC name is N,N,2-trimethyl-6-phenylhexa-3,5-diyn-2-amine.
| Compound Name | N,N,2-trimethyl-6-phenylhexa-3,5-diyn-2-amine |
|---|---|
| PubChem CID | 3311064 |
| Molecular Formula | C15H17N |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | N,N,2-trimethyl-6-phenylhexa-3,5-diyn-2-amine |
| SMILES | CN(C)C(C)(C)C#CC#Cc1ccccc1 |
| InChI | InChI=1S/C15H17N/c1-15(2,16(3)4)13-9-8-12-14-10-6-5-7-11-14/h5-7,10-11H,1-4H3 |
| InChIKey | ROHKEOWBTVERNT-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|