About 3-(2,4-dimethylphenyl)-1,1-dipropylurea
3-(2,4-dimethylphenyl)-1,1-dipropylurea (PubChem CID 3311942) has the molecular formula C15H24N2O
and a molecular weight of 248.37 g/mol. Its IUPAC name is 3-(2,4-dimethylphenyl)-1,1-dipropylurea.
Molecular Properties
| Compound Name | 3-(2,4-dimethylphenyl)-1,1-dipropylurea |
| PubChem CID | 3311942 |
| Molecular Formula | C15H24N2O |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | 3-(2,4-dimethylphenyl)-1,1-dipropylurea |
| SMILES | CCCN(CCC)C(=O)Nc1ccc(C)cc1C |
| InChI | InChI=1S/C15H24N2O/c1-5-9-17(10-6-2)15(18)16-14-8-7-12(3)11-13(14)4/h7-8,11H,5-6,9-10H2,1-4H3,(H,16,18) |
| InChIKey | MRQMPEAFTOYAQN-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-(2,4-dimethylphenyl)-1,1-dipropylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,4-dimethylphenyl)-1,1-dipropylurea?
The IUPAC name of 3-(2,4-dimethylphenyl)-1,1-dipropylurea (CID 3311942) is 3-(2,4-dimethylphenyl)-1,1-dipropylurea.
What is the SMILES notation for 3-(2,4-dimethylphenyl)-1,1-dipropylurea?
The canonical SMILES for 3-(2,4-dimethylphenyl)-1,1-dipropylurea is CCCN(CCC)C(=O)Nc1ccc(C)cc1C.
What is the InChIKey of 3-(2,4-dimethylphenyl)-1,1-dipropylurea?
The InChIKey is MRQMPEAFTOYAQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N2O/c1-5-9-17(10-6-2)15(18)16-14-8-7-12(3)11-13(14)4/h7-8,11H,5-6,9-10H2,1-4H3,(H,16,18).
What are the key properties of 3-(2,4-dimethylphenyl)-1,1-dipropylurea?
3-(2,4-dimethylphenyl)-1,1-dipropylurea has a molecular weight of 248.37 g/mol, XLogP of 3.96, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,4-dimethylphenyl)-1,1-dipropylurea is sourced from PubChem (CID 3311942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).