C28H24N4O3 — CID 3312378
N-[1-[(dibenzylamino)methyl]-2-hydroxyindol-3-yl]iminofuran-2-carboxamide (PubChem CID 3312378) has the molecular formula C28H24N4O3 and a molecular weight of 464.53 g/mol. Its IUPAC name is N-[1-[(dibenzylamino)methyl]-2-hydroxyindol-3-yl]iminofuran-2-carboxamide.
| Compound Name | N-[1-[(dibenzylamino)methyl]-2-hydroxyindol-3-yl]iminofuran-2-carboxamide |
|---|---|
| PubChem CID | 3312378 |
| Molecular Formula | C28H24N4O3 |
| Molecular Weight | 464.53 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | N-[1-[(dibenzylamino)methyl]-2-hydroxyindol-3-yl]iminofuran-2-carboxamide |
| SMILES | O=C(/N=N/c1c(O)n(CN(Cc2ccccc2)Cc2ccccc2)c2ccccc12)c1ccco1 |
| InChI | InChI=1S/C28H24N4O3/c33-27(25-16-9-17-35-25)30-29-26-23-14-7-8-15-24(23)32(28(26)34)20-31(18-21-10-3-1-4-11-21)19-22-12-5-2-6-13-22/h1-17,34H,18-20H2/b30-29+ |
| InChIKey | GULXSJZQNHQMRM-QVIHXGFCSA-N |
| XLogP | 6.52 |
| TPSA | 83.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.53 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|