C30H34N2O4S — CID 3312506
2-[4-[3-(4-tert-butylphenoxy)propoxy]-3-methoxyphenyl]-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 3312506) has the molecular formula C30H34N2O4S and a molecular weight of 518.68 g/mol. Its IUPAC name is 2-[4-[3-(4-tert-butylphenoxy)propoxy]-3-methoxyphenyl]-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 2-[4-[3-(4-tert-butylphenoxy)propoxy]-3-methoxyphenyl]-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 3312506 |
| Molecular Formula | C30H34N2O4S |
| Molecular Weight | 518.68 g/mol |
| Exact Mass | 518.22 |
| IUPAC Name | 2-[4-[3-(4-tert-butylphenoxy)propoxy]-3-methoxyphenyl]-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | COc1cc(-c2nc3sc4c(c3c(=O)[nH]2)CCCC4)ccc1OCCCOc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C30H34N2O4S/c1-30(2,3)20-11-13-21(14-12-20)35-16-7-17-36-23-15-10-19(18-24(23)34-4)27-31-28(33)26-22-8-5-6-9-25(22)37-29(26)32-27/h10-15,18H,5-9,16-17H2,1-4H3,(H,31,32,33) |
| InChIKey | HLUILAWRQHTTGI-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 73.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.68 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|