About 1-[2-[1-(2,6-dimethylphenyl)tetrazol-5-yl]propan-2-yl]-4-nitrosopiperazine
1-[2-[1-(2,6-dimethylphenyl)tetrazol-5-yl]propan-2-yl]-4-nitrosopiperazine (PubChem CID 3312555) has the molecular formula C16H23N7O
and a molecular weight of 329.41 g/mol. Its IUPAC name is 1-[2-[1-(2,6-dimethylphenyl)tetrazol-5-yl]propan-2-yl]-4-nitrosopiperazine.
Molecular Properties
| Compound Name | 1-[2-[1-(2,6-dimethylphenyl)tetrazol-5-yl]propan-2-yl]-4-nitrosopiperazine |
| PubChem CID | 3312555 |
| Molecular Formula | C16H23N7O |
| Molecular Weight | 329.41 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | 1-[2-[1-(2,6-dimethylphenyl)tetrazol-5-yl]propan-2-yl]-4-nitrosopiperazine |
| SMILES | Cc1cccc(C)c1-n1nnnc1C(C)(C)N1CCN(N=O)CC1 |
| InChI | InChI=1S/C16H23N7O/c1-12-6-5-7-13(2)14(12)23-15(17-18-19-23)16(3,4)21-8-10-22(20-24)11-9-21/h5-7H,8-11H2,1-4H3 |
| InChIKey | ABSQHHIGECLLBT-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 79.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.41 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-[1-(2,6-dimethylphenyl)tetrazol-5-yl]propan-2-yl]-4-nitrosopiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[1-(2,6-dimethylphenyl)tetrazol-5-yl]propan-2-yl]-4-nitrosopiperazine?
The IUPAC name of 1-[2-[1-(2,6-dimethylphenyl)tetrazol-5-yl]propan-2-yl]-4-nitrosopiperazine (CID 3312555) is 1-[2-[1-(2,6-dimethylphenyl)tetrazol-5-yl]propan-2-yl]-4-nitrosopiperazine.
What is the SMILES notation for 1-[2-[1-(2,6-dimethylphenyl)tetrazol-5-yl]propan-2-yl]-4-nitrosopiperazine?
The canonical SMILES for 1-[2-[1-(2,6-dimethylphenyl)tetrazol-5-yl]propan-2-yl]-4-nitrosopiperazine is Cc1cccc(C)c1-n1nnnc1C(C)(C)N1CCN(N=O)CC1.
What is the InChIKey of 1-[2-[1-(2,6-dimethylphenyl)tetrazol-5-yl]propan-2-yl]-4-nitrosopiperazine?
The InChIKey is ABSQHHIGECLLBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23N7O/c1-12-6-5-7-13(2)14(12)23-15(17-18-19-23)16(3,4)21-8-10-22(20-24)11-9-21/h5-7H,8-11H2,1-4H3.
What are the key properties of 1-[2-[1-(2,6-dimethylphenyl)tetrazol-5-yl]propan-2-yl]-4-nitrosopiperazine?
1-[2-[1-(2,6-dimethylphenyl)tetrazol-5-yl]propan-2-yl]-4-nitrosopiperazine has a molecular weight of 329.41 g/mol, XLogP of 1.81, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[1-(2,6-dimethylphenyl)tetrazol-5-yl]propan-2-yl]-4-nitrosopiperazine is sourced from PubChem (CID 3312555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).