C20H21FN4O2 — CID 33129978
N-[5-[(dimethylamino)methyl]-2-methoxyphenyl]-1-(4-fluorophenyl)pyrazole-3-carboxamide (PubChem CID 33129978) has the molecular formula C20H21FN4O2 and a molecular weight of 368.41 g/mol. Its IUPAC name is N-[5-[(dimethylamino)methyl]-2-methoxyphenyl]-1-(4-fluorophenyl)pyrazole-3-carboxamide.
| Compound Name | N-[5-[(dimethylamino)methyl]-2-methoxyphenyl]-1-(4-fluorophenyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 33129978 |
| Molecular Formula | C20H21FN4O2 |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | N-[5-[(dimethylamino)methyl]-2-methoxyphenyl]-1-(4-fluorophenyl)pyrazole-3-carboxamide |
| SMILES | COc1ccc(CN(C)C)cc1NC(=O)c1ccn(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C20H21FN4O2/c1-24(2)13-14-4-9-19(27-3)18(12-14)22-20(26)17-10-11-25(23-17)16-7-5-15(21)6-8-16/h4-12H,13H2,1-3H3,(H,22,26) |
| InChIKey | FBBOXYLRRXASGW-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |