About 4-propyl-3-[[4-(trifluoromethoxy)phenyl]methylsulfanyl]-1H-1,2,4-triazol-5-one
4-propyl-3-[[4-(trifluoromethoxy)phenyl]methylsulfanyl]-1H-1,2,4-triazol-5-one (PubChem CID 33131001) has the molecular formula C13H14F3N3O2S
and a molecular weight of 333.34 g/mol. Its IUPAC name is 4-propyl-3-[[4-(trifluoromethoxy)phenyl]methylsulfanyl]-1H-1,2,4-triazol-5-one.
Molecular Properties
| Compound Name | 4-propyl-3-[[4-(trifluoromethoxy)phenyl]methylsulfanyl]-1H-1,2,4-triazol-5-one |
| PubChem CID | 33131001 |
| Molecular Formula | C13H14F3N3O2S |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | 4-propyl-3-[[4-(trifluoromethoxy)phenyl]methylsulfanyl]-1H-1,2,4-triazol-5-one |
| SMILES | CCCn1c(SCc2ccc(OC(F)(F)F)cc2)n[nH]c1=O |
| InChI | InChI=1S/C13H14F3N3O2S/c1-2-7-19-11(20)17-18-12(19)22-8-9-3-5-10(6-4-9)21-13(14,15)16/h3-6H,2,7-8H2,1H3,(H,17,20) |
| InChIKey | UERQOZQLIIFBIR-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 59.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-propyl-3-[[4-(trifluoromethoxy)phenyl]methylsulfanyl]-1H-1,2,4-triazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-propyl-3-[[4-(trifluoromethoxy)phenyl]methylsulfanyl]-1H-1,2,4-triazol-5-one?
The IUPAC name of 4-propyl-3-[[4-(trifluoromethoxy)phenyl]methylsulfanyl]-1H-1,2,4-triazol-5-one (CID 33131001) is 4-propyl-3-[[4-(trifluoromethoxy)phenyl]methylsulfanyl]-1H-1,2,4-triazol-5-one.
What is the SMILES notation for 4-propyl-3-[[4-(trifluoromethoxy)phenyl]methylsulfanyl]-1H-1,2,4-triazol-5-one?
The canonical SMILES for 4-propyl-3-[[4-(trifluoromethoxy)phenyl]methylsulfanyl]-1H-1,2,4-triazol-5-one is CCCn1c(SCc2ccc(OC(F)(F)F)cc2)n[nH]c1=O.
What is the InChIKey of 4-propyl-3-[[4-(trifluoromethoxy)phenyl]methylsulfanyl]-1H-1,2,4-triazol-5-one?
The InChIKey is UERQOZQLIIFBIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14F3N3O2S/c1-2-7-19-11(20)17-18-12(19)22-8-9-3-5-10(6-4-9)21-13(14,15)16/h3-6H,2,7-8H2,1H3,(H,17,20).
What are the key properties of 4-propyl-3-[[4-(trifluoromethoxy)phenyl]methylsulfanyl]-1H-1,2,4-triazol-5-one?
4-propyl-3-[[4-(trifluoromethoxy)phenyl]methylsulfanyl]-1H-1,2,4-triazol-5-one has a molecular weight of 333.34 g/mol, XLogP of 3.17, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-propyl-3-[[4-(trifluoromethoxy)phenyl]methylsulfanyl]-1H-1,2,4-triazol-5-one is sourced from PubChem (CID 33131001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).