C21H20F3N3O3 — CID 3313547
4-(2-oxo-5-phenyl-1,3-oxazolidin-3-yl)-N-(2,3,4-trifluorophenyl)piperidine-1-carboxamide (PubChem CID 3313547) has the molecular formula C21H20F3N3O3 and a molecular weight of 419.40 g/mol. Its IUPAC name is 4-(2-oxo-5-phenyl-1,3-oxazolidin-3-yl)-N-(2,3,4-trifluorophenyl)piperidine-1-carboxamide.
| Compound Name | 4-(2-oxo-5-phenyl-1,3-oxazolidin-3-yl)-N-(2,3,4-trifluorophenyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 3313547 |
| Molecular Formula | C21H20F3N3O3 |
| Molecular Weight | 419.40 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | 4-(2-oxo-5-phenyl-1,3-oxazolidin-3-yl)-N-(2,3,4-trifluorophenyl)piperidine-1-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(F)c1F)N1CCC(N2CC(c3ccccc3)OC2=O)CC1 |
| InChI | InChI=1S/C21H20F3N3O3/c22-15-6-7-16(19(24)18(15)23)25-20(28)26-10-8-14(9-11-26)27-12-17(30-21(27)29)13-4-2-1-3-5-13/h1-7,14,17H,8-12H2,(H,25,28) |
| InChIKey | IMLVXJIFPDMZKL-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.40 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|