C25H20FN3O4S — CID 3313924
5-[(4-fluorophenyl)iminomethyl]-6-hydroxy-1,3-bis(4-methoxyphenyl)-2-sulfanylidenepyrimidin-4-one (PubChem CID 3313924) has the molecular formula C25H20FN3O4S and a molecular weight of 477.52 g/mol. Its IUPAC name is 5-[(4-fluorophenyl)iminomethyl]-6-hydroxy-1,3-bis(4-methoxyphenyl)-2-sulfanylidenepyrimidin-4-one.
| Compound Name | 5-[(4-fluorophenyl)iminomethyl]-6-hydroxy-1,3-bis(4-methoxyphenyl)-2-sulfanylidenepyrimidin-4-one |
|---|---|
| PubChem CID | 3313924 |
| Molecular Formula | C25H20FN3O4S |
| Molecular Weight | 477.52 g/mol |
| Exact Mass | 477.12 |
| IUPAC Name | 5-[(4-fluorophenyl)iminomethyl]-6-hydroxy-1,3-bis(4-methoxyphenyl)-2-sulfanylidenepyrimidin-4-one |
| SMILES | COc1ccc(-n2c(O)c(/C=N/c3ccc(F)cc3)c(=O)n(-c3ccc(OC)cc3)c2=S)cc1 |
| InChI | InChI=1S/C25H20FN3O4S/c1-32-20-11-7-18(8-12-20)28-23(30)22(15-27-17-5-3-16(26)4-6-17)24(31)29(25(28)34)19-9-13-21(33-2)14-10-19/h3-15,30H,1-2H3/b27-15+ |
| InChIKey | HDDOPBBZNGTPAF-JFLMPSFJSA-N |
| XLogP | 4.97 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.52 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|