C18H16FNO4S — CID 3313953
methyl 4-(benzenesulfonyl)-5-(4-fluoroanilino)penta-2,4-dienoate (PubChem CID 3313953) has the molecular formula C18H16FNO4S and a molecular weight of 361.39 g/mol. Its IUPAC name is methyl 4-(benzenesulfonyl)-5-(4-fluoroanilino)penta-2,4-dienoate.
| Compound Name | methyl 4-(benzenesulfonyl)-5-(4-fluoroanilino)penta-2,4-dienoate |
|---|---|
| PubChem CID | 3313953 |
| Molecular Formula | C18H16FNO4S |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | methyl 4-(benzenesulfonyl)-5-(4-fluoroanilino)penta-2,4-dienoate |
| SMILES | COC(=O)C=CC(=CNc1ccc(F)cc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H16FNO4S/c1-24-18(21)12-11-17(13-20-15-9-7-14(19)8-10-15)25(22,23)16-5-3-2-4-6-16/h2-13,20H,1H3 |
| InChIKey | XHUUOLANMDUIAS-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|