C14H6N2O2Se — CID 3314021
naphtho[2,3-g][2,1,3]benzoselenadiazole-6,11-dione (PubChem CID 3314021) has the molecular formula C14H6N2O2Se and a molecular weight of 313.17 g/mol. Its IUPAC name is naphtho[2,3-g][2,1,3]benzoselenadiazole-6,11-dione.
| Compound Name | naphtho[2,3-g][2,1,3]benzoselenadiazole-6,11-dione |
|---|---|
| PubChem CID | 3314021 |
| Molecular Formula | C14H6N2O2Se |
| Molecular Weight | 313.17 g/mol |
| Exact Mass | 313.96 |
| IUPAC Name | naphtho[2,3-g][2,1,3]benzoselenadiazole-6,11-dione |
| SMILES | O=C1c2ccccc2C(=O)c2c1ccc1n[se]nc21 |
| InChI | InChI=1S/C14H6N2O2Se/c17-13-7-3-1-2-4-8(7)14(18)11-9(13)5-6-10-12(11)16-19-15-10/h1-6H |
| InChIKey | GECUUSZVAWIRDD-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.17 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|