About 2-(1-adamantyl)guanidine
2-(1-adamantyl)guanidine (PubChem CID 3314089) has the molecular formula C11H19N3
and a molecular weight of 193.29 g/mol. Its IUPAC name is 2-(1-adamantyl)guanidine.
Molecular Properties
| Compound Name | 2-(1-adamantyl)guanidine |
| PubChem CID | 3314089 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | 2-(1-adamantyl)guanidine |
| SMILES | NC(N)=NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C11H19N3/c12-10(13)14-11-4-7-1-8(5-11)3-9(2-7)6-11/h7-9H,1-6H2,(H4,12,13,14) |
| InChIKey | LFYYWNBMKVGMPJ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-adamantyl)guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-adamantyl)guanidine?
The IUPAC name of 2-(1-adamantyl)guanidine (CID 3314089) is 2-(1-adamantyl)guanidine.
What is the SMILES notation for 2-(1-adamantyl)guanidine?
The canonical SMILES for 2-(1-adamantyl)guanidine is NC(N)=NC12CC3CC(CC(C3)C1)C2.
What is the InChIKey of 2-(1-adamantyl)guanidine?
The InChIKey is LFYYWNBMKVGMPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N3/c12-10(13)14-11-4-7-1-8(5-11)3-9(2-7)6-11/h7-9H,1-6H2,(H4,12,13,14).
What are the key properties of 2-(1-adamantyl)guanidine?
2-(1-adamantyl)guanidine has a molecular weight of 193.29 g/mol, XLogP of 1.23, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-adamantyl)guanidine is sourced from PubChem (CID 3314089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).