C21H23BrN2O5S — CID 33149207
[2-(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)-2-oxoethyl] 2-bromo-5-(prop-2-enylsulfamoyl)benzoate (PubChem CID 33149207) has the molecular formula C21H23BrN2O5S and a molecular weight of 495.40 g/mol. Its IUPAC name is [2-(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)-2-oxoethyl] 2-bromo-5-(prop-2-enylsulfamoyl)benzoate.
| Compound Name | [2-(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)-2-oxoethyl] 2-bromo-5-(prop-2-enylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 33149207 |
| Molecular Formula | C21H23BrN2O5S |
| Molecular Weight | 495.40 g/mol |
| Exact Mass | 494.05 |
| IUPAC Name | [2-(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)-2-oxoethyl] 2-bromo-5-(prop-2-enylsulfamoyl)benzoate |
| SMILES | C=CCNS(=O)(=O)c1ccc(Br)c(C(=O)OCC(=O)c2cc(C)n(C3CC3)c2C)c1 |
| InChI | InChI=1S/C21H23BrN2O5S/c1-4-9-23-30(27,28)16-7-8-19(22)18(11-16)21(26)29-12-20(25)17-10-13(2)24(14(17)3)15-5-6-15/h4,7-8,10-11,15,23H,1,5-6,9,12H2,2-3H3 |
| InChIKey | ZKLKVHWVJIREOP-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 94.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.40 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|