C22H23N3O3 — CID 33168189
2-(1,2-benzoxazol-3-yl)-1-[4-(4-ethylbenzoyl)piperazin-1-yl]ethanone (PubChem CID 33168189) has the molecular formula C22H23N3O3 and a molecular weight of 377.44 g/mol. Its IUPAC name is 2-(1,2-benzoxazol-3-yl)-1-[4-(4-ethylbenzoyl)piperazin-1-yl]ethanone.
| Compound Name | 2-(1,2-benzoxazol-3-yl)-1-[4-(4-ethylbenzoyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 33168189 |
| Molecular Formula | C22H23N3O3 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | 2-(1,2-benzoxazol-3-yl)-1-[4-(4-ethylbenzoyl)piperazin-1-yl]ethanone |
| SMILES | CCc1ccc(C(=O)N2CCN(C(=O)Cc3noc4ccccc34)CC2)cc1 |
| InChI | InChI=1S/C22H23N3O3/c1-2-16-7-9-17(10-8-16)22(27)25-13-11-24(12-14-25)21(26)15-19-18-5-3-4-6-20(18)28-23-19/h3-10H,2,11-15H2,1H3 |
| InChIKey | OFXUYARKNRGDEM-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 66.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |