C21H20N2O3 — CID 3316951
2,9-dimethyl-19-nitro-21-oxa-2-azapentacyclo[11.8.0.01,9.03,8.015,20]henicosa-3,5,7,13,15(20),16,18-heptaene (PubChem CID 3316951) has the molecular formula C21H20N2O3 and a molecular weight of 348.40 g/mol. Its IUPAC name is 2,9-dimethyl-19-nitro-21-oxa-2-azapentacyclo[11.8.0.01,9.03,8.015,20]henicosa-3,5,7,13,15(20),16,18-heptaene.
| Compound Name | 2,9-dimethyl-19-nitro-21-oxa-2-azapentacyclo[11.8.0.01,9.03,8.015,20]henicosa-3,5,7,13,15(20),16,18-heptaene |
|---|---|
| PubChem CID | 3316951 |
| Molecular Formula | C21H20N2O3 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | 2,9-dimethyl-19-nitro-21-oxa-2-azapentacyclo[11.8.0.01,9.03,8.015,20]henicosa-3,5,7,13,15(20),16,18-heptaene |
| SMILES | CN1c2ccccc2C2(C)CCCC3=Cc4cccc([N+](=O)[O-])c4OC312 |
| InChI | InChI=1S/C21H20N2O3/c1-20-12-6-8-15-13-14-7-5-11-18(23(24)25)19(14)26-21(15,20)22(2)17-10-4-3-9-16(17)20/h3-5,7,9-11,13H,6,8,12H2,1-2H3 |
| InChIKey | AOQKMJVGELKIIG-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|