C13H18N4O5 — CID 33174069
2-(2-methoxy-5-nitroanilino)-N-(propylcarbamoyl)acetamide (PubChem CID 33174069) has the molecular formula C13H18N4O5 and a molecular weight of 310.31 g/mol. Its IUPAC name is 2-(2-methoxy-5-nitroanilino)-N-(propylcarbamoyl)acetamide.
| Compound Name | 2-(2-methoxy-5-nitroanilino)-N-(propylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 33174069 |
| Molecular Formula | C13H18N4O5 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | 2-(2-methoxy-5-nitroanilino)-N-(propylcarbamoyl)acetamide |
| SMILES | CCCNC(=O)NC(=O)CNc1cc([N+](=O)[O-])ccc1OC |
| InChI | InChI=1S/C13H18N4O5/c1-3-6-14-13(19)16-12(18)8-15-10-7-9(17(20)21)4-5-11(10)22-2/h4-5,7,15H,3,6,8H2,1-2H3,(H2,14,16,18,19) |
| InChIKey | YLJGVADANSSJAD-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|