C13H13Cl2N5OS2 — CID 3317623
3,4-dichloro-N-[(3-ethylsulfanyl-5-methyl-1,2,4-triazol-4-yl)carbamothioyl]benzamide (PubChem CID 3317623) has the molecular formula C13H13Cl2N5OS2 and a molecular weight of 390.32 g/mol. Its IUPAC name is 3,4-dichloro-N-[(3-ethylsulfanyl-5-methyl-1,2,4-triazol-4-yl)carbamothioyl]benzamide.
| Compound Name | 3,4-dichloro-N-[(3-ethylsulfanyl-5-methyl-1,2,4-triazol-4-yl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 3317623 |
| Molecular Formula | C13H13Cl2N5OS2 |
| Molecular Weight | 390.32 g/mol |
| Exact Mass | 388.99 |
| IUPAC Name | 3,4-dichloro-N-[(3-ethylsulfanyl-5-methyl-1,2,4-triazol-4-yl)carbamothioyl]benzamide |
| SMILES | CCSc1nnc(C)n1NC(=S)NC(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H13Cl2N5OS2/c1-3-23-13-18-17-7(2)20(13)19-12(22)16-11(21)8-4-5-9(14)10(15)6-8/h4-6H,3H2,1-2H3,(H2,16,19,21,22) |
| InChIKey | XAUKMFNVAXWZPT-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.32 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|