About N-benzo[g][1,3]benzothiazol-2-yl-2,4-dimethylbenzamide
N-benzo[g][1,3]benzothiazol-2-yl-2,4-dimethylbenzamide (PubChem CID 3318017) has the molecular formula C20H16N2OS
and a molecular weight of 332.43 g/mol. Its IUPAC name is N-benzo[g][1,3]benzothiazol-2-yl-2,4-dimethylbenzamide.
Molecular Properties
| Compound Name | N-benzo[g][1,3]benzothiazol-2-yl-2,4-dimethylbenzamide |
| PubChem CID | 3318017 |
| Molecular Formula | C20H16N2OS |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | N-benzo[g][1,3]benzothiazol-2-yl-2,4-dimethylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2nc3ccc4ccccc4c3s2)c(C)c1 |
| InChI | InChI=1S/C20H16N2OS/c1-12-7-9-15(13(2)11-12)19(23)22-20-21-17-10-8-14-5-3-4-6-16(14)18(17)24-20/h3-11H,1-2H3,(H,21,22,23) |
| InChIKey | RFDWULOSYVRYGW-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-benzo[g][1,3]benzothiazol-2-yl-2,4-dimethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzo[g][1,3]benzothiazol-2-yl-2,4-dimethylbenzamide?
The IUPAC name of N-benzo[g][1,3]benzothiazol-2-yl-2,4-dimethylbenzamide (CID 3318017) is N-benzo[g][1,3]benzothiazol-2-yl-2,4-dimethylbenzamide.
What is the SMILES notation for N-benzo[g][1,3]benzothiazol-2-yl-2,4-dimethylbenzamide?
The canonical SMILES for N-benzo[g][1,3]benzothiazol-2-yl-2,4-dimethylbenzamide is Cc1ccc(C(=O)Nc2nc3ccc4ccccc4c3s2)c(C)c1.
What is the InChIKey of N-benzo[g][1,3]benzothiazol-2-yl-2,4-dimethylbenzamide?
The InChIKey is RFDWULOSYVRYGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16N2OS/c1-12-7-9-15(13(2)11-12)19(23)22-20-21-17-10-8-14-5-3-4-6-16(14)18(17)24-20/h3-11H,1-2H3,(H,21,22,23).
What are the key properties of N-benzo[g][1,3]benzothiazol-2-yl-2,4-dimethylbenzamide?
N-benzo[g][1,3]benzothiazol-2-yl-2,4-dimethylbenzamide has a molecular weight of 332.43 g/mol, XLogP of 5.32, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzo[g][1,3]benzothiazol-2-yl-2,4-dimethylbenzamide is sourced from PubChem (CID 3318017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).