C29H26ClN3O4S — CID 3318602
4-chloro-3-[(3-methylphenyl)sulfamoyl]-N-[2-(1-phenylethylcarbamoyl)phenyl]benzamide (PubChem CID 3318602) has the molecular formula C29H26ClN3O4S and a molecular weight of 548.06 g/mol. Its IUPAC name is 4-chloro-3-[(3-methylphenyl)sulfamoyl]-N-[2-(1-phenylethylcarbamoyl)phenyl]benzamide.
| Compound Name | 4-chloro-3-[(3-methylphenyl)sulfamoyl]-N-[2-(1-phenylethylcarbamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 3318602 |
| Molecular Formula | C29H26ClN3O4S |
| Molecular Weight | 548.06 g/mol |
| Exact Mass | 547.13 |
| IUPAC Name | 4-chloro-3-[(3-methylphenyl)sulfamoyl]-N-[2-(1-phenylethylcarbamoyl)phenyl]benzamide |
| SMILES | Cc1cccc(NS(=O)(=O)c2cc(C(=O)Nc3ccccc3C(=O)NC(C)c3ccccc3)ccc2Cl)c1 |
| InChI | InChI=1S/C29H26ClN3O4S/c1-19-9-8-12-23(17-19)33-38(36,37)27-18-22(15-16-25(27)30)28(34)32-26-14-7-6-13-24(26)29(35)31-20(2)21-10-4-3-5-11-21/h3-18,20,33H,1-2H3,(H,31,35)(H,32,34) |
| InChIKey | ICVPOQDTXGRJIJ-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.06 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |