C13H22NO+ — CID 3319304
4-but-3-en-1-ynyl-1,1,2,5-tetramethylpiperidin-1-ium-4-ol (PubChem CID 3319304) has the molecular formula C13H22NO+ and a molecular weight of 208.32 g/mol. Its IUPAC name is 4-but-3-en-1-ynyl-1,1,2,5-tetramethylpiperidin-1-ium-4-ol.
| Compound Name | 4-but-3-en-1-ynyl-1,1,2,5-tetramethylpiperidin-1-ium-4-ol |
|---|---|
| PubChem CID | 3319304 |
| Molecular Formula | C13H22NO+ |
| Molecular Weight | 208.32 g/mol |
| Exact Mass | 208.17 |
| IUPAC Name | 4-but-3-en-1-ynyl-1,1,2,5-tetramethylpiperidin-1-ium-4-ol |
| SMILES | C=CC#CC1(O)CC(C)[N+](C)(C)CC1C |
| InChI | InChI=1S/C13H22NO/c1-6-7-8-13(15)9-12(3)14(4,5)10-11(13)2/h6,11-12,15H,1,9-10H2,2-5H3/q+1 |
| InChIKey | AZFNTQRIGXUFRT-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.32 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|