About 2-phenacyl-2,4-diphenyl-6,7-dihydro-5H-chromen-8-one
2-phenacyl-2,4-diphenyl-6,7-dihydro-5H-chromen-8-one (PubChem CID 3319467) has the molecular formula C29H24O3
and a molecular weight of 420.51 g/mol. Its IUPAC name is 2-phenacyl-2,4-diphenyl-6,7-dihydro-5H-chromen-8-one.
Molecular Properties
| Compound Name | 2-phenacyl-2,4-diphenyl-6,7-dihydro-5H-chromen-8-one |
| PubChem CID | 3319467 |
| Molecular Formula | C29H24O3 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | 2-phenacyl-2,4-diphenyl-6,7-dihydro-5H-chromen-8-one |
| SMILES | O=C1CCCC2=C1OC(CC(=O)c1ccccc1)(c1ccccc1)C=C2c1ccccc1 |
| InChI | InChI=1S/C29H24O3/c30-26-18-10-17-24-25(21-11-4-1-5-12-21)19-29(32-28(24)26,23-15-8-3-9-16-23)20-27(31)22-13-6-2-7-14-22/h1-9,11-16,19H,10,17-18,20H2 |
| InChIKey | AYRSKISQYSGZHT-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-phenacyl-2,4-diphenyl-6,7-dihydro-5H-chromen-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenacyl-2,4-diphenyl-6,7-dihydro-5H-chromen-8-one?
The IUPAC name of 2-phenacyl-2,4-diphenyl-6,7-dihydro-5H-chromen-8-one (CID 3319467) is 2-phenacyl-2,4-diphenyl-6,7-dihydro-5H-chromen-8-one.
What is the SMILES notation for 2-phenacyl-2,4-diphenyl-6,7-dihydro-5H-chromen-8-one?
The canonical SMILES for 2-phenacyl-2,4-diphenyl-6,7-dihydro-5H-chromen-8-one is O=C1CCCC2=C1OC(CC(=O)c1ccccc1)(c1ccccc1)C=C2c1ccccc1.
What is the InChIKey of 2-phenacyl-2,4-diphenyl-6,7-dihydro-5H-chromen-8-one?
The InChIKey is AYRSKISQYSGZHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H24O3/c30-26-18-10-17-24-25(21-11-4-1-5-12-21)19-29(32-28(24)26,23-15-8-3-9-16-23)20-27(31)22-13-6-2-7-14-22/h1-9,11-16,19H,10,17-18,20H2.
What are the key properties of 2-phenacyl-2,4-diphenyl-6,7-dihydro-5H-chromen-8-one?
2-phenacyl-2,4-diphenyl-6,7-dihydro-5H-chromen-8-one has a molecular weight of 420.51 g/mol, XLogP of 6.28, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenacyl-2,4-diphenyl-6,7-dihydro-5H-chromen-8-one is sourced from PubChem (CID 3319467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).