About benzo[b][1,4]benzoxazepin-6-amine
benzo[b][1,4]benzoxazepin-6-amine (PubChem CID 3320059) has the molecular formula C13H10N2O
and a molecular weight of 210.24 g/mol. Its IUPAC name is benzo[b][1,4]benzoxazepin-6-amine.
Molecular Properties
| Compound Name | benzo[b][1,4]benzoxazepin-6-amine |
| PubChem CID | 3320059 |
| Molecular Formula | C13H10N2O |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | benzo[b][1,4]benzoxazepin-6-amine |
| SMILES | NC1=Nc2ccccc2Oc2ccccc21 |
| InChI | InChI=1S/C13H10N2O/c14-13-9-5-1-3-7-11(9)16-12-8-4-2-6-10(12)15-13/h1-8H,(H2,14,15) |
| InChIKey | WJWDEWXJRCMLMU-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze benzo[b][1,4]benzoxazepin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzo[b][1,4]benzoxazepin-6-amine?
The IUPAC name of benzo[b][1,4]benzoxazepin-6-amine (CID 3320059) is benzo[b][1,4]benzoxazepin-6-amine.
What is the SMILES notation for benzo[b][1,4]benzoxazepin-6-amine?
The canonical SMILES for benzo[b][1,4]benzoxazepin-6-amine is NC1=Nc2ccccc2Oc2ccccc21.
What is the InChIKey of benzo[b][1,4]benzoxazepin-6-amine?
The InChIKey is WJWDEWXJRCMLMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N2O/c14-13-9-5-1-3-7-11(9)16-12-8-4-2-6-10(12)15-13/h1-8H,(H2,14,15).
What are the key properties of benzo[b][1,4]benzoxazepin-6-amine?
benzo[b][1,4]benzoxazepin-6-amine has a molecular weight of 210.24 g/mol, XLogP of 2.83, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzo[b][1,4]benzoxazepin-6-amine is sourced from PubChem (CID 3320059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).