About N-tert-butyl-6-methyl-2,4-dioxo-1H-pyrimidine-5-sulfonamide
N-tert-butyl-6-methyl-2,4-dioxo-1H-pyrimidine-5-sulfonamide (PubChem CID 3320329) has the molecular formula C9H15N3O4S
and a molecular weight of 261.30 g/mol. Its IUPAC name is N-tert-butyl-6-methyl-2,4-dioxo-1H-pyrimidine-5-sulfonamide.
Molecular Properties
| Compound Name | N-tert-butyl-6-methyl-2,4-dioxo-1H-pyrimidine-5-sulfonamide |
| PubChem CID | 3320329 |
| Molecular Formula | C9H15N3O4S |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | N-tert-butyl-6-methyl-2,4-dioxo-1H-pyrimidine-5-sulfonamide |
| SMILES | Cc1[nH]c(=O)[nH]c(=O)c1S(=O)(=O)NC(C)(C)C |
| InChI | InChI=1S/C9H15N3O4S/c1-5-6(7(13)11-8(14)10-5)17(15,16)12-9(2,3)4/h12H,1-4H3,(H2,10,11,13,14) |
| InChIKey | TUJSRTDNYWFIKC-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 111.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-tert-butyl-6-methyl-2,4-dioxo-1H-pyrimidine-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-6-methyl-2,4-dioxo-1H-pyrimidine-5-sulfonamide?
The IUPAC name of N-tert-butyl-6-methyl-2,4-dioxo-1H-pyrimidine-5-sulfonamide (CID 3320329) is N-tert-butyl-6-methyl-2,4-dioxo-1H-pyrimidine-5-sulfonamide.
What is the SMILES notation for N-tert-butyl-6-methyl-2,4-dioxo-1H-pyrimidine-5-sulfonamide?
The canonical SMILES for N-tert-butyl-6-methyl-2,4-dioxo-1H-pyrimidine-5-sulfonamide is Cc1[nH]c(=O)[nH]c(=O)c1S(=O)(=O)NC(C)(C)C.
What is the InChIKey of N-tert-butyl-6-methyl-2,4-dioxo-1H-pyrimidine-5-sulfonamide?
The InChIKey is TUJSRTDNYWFIKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3O4S/c1-5-6(7(13)11-8(14)10-5)17(15,16)12-9(2,3)4/h12H,1-4H3,(H2,10,11,13,14).
What are the key properties of N-tert-butyl-6-methyl-2,4-dioxo-1H-pyrimidine-5-sulfonamide?
N-tert-butyl-6-methyl-2,4-dioxo-1H-pyrimidine-5-sulfonamide has a molecular weight of 261.30 g/mol, XLogP of -0.55, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-6-methyl-2,4-dioxo-1H-pyrimidine-5-sulfonamide is sourced from PubChem (CID 3320329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).