About 3-phenyl-7-(3-phenylpyrrolidin-1-yl)-5-propyl-[1,3]thiazolo[4,5-d]pyrimidine-2-thione
3-phenyl-7-(3-phenylpyrrolidin-1-yl)-5-propyl-[1,3]thiazolo[4,5-d]pyrimidine-2-thione (PubChem CID 3320394) has the molecular formula C24H24N4S2
and a molecular weight of 432.62 g/mol. Its IUPAC name is 3-phenyl-7-(3-phenylpyrrolidin-1-yl)-5-propyl-[1,3]thiazolo[4,5-d]pyrimidine-2-thione.
Molecular Properties
| Compound Name | 3-phenyl-7-(3-phenylpyrrolidin-1-yl)-5-propyl-[1,3]thiazolo[4,5-d]pyrimidine-2-thione |
| PubChem CID | 3320394 |
| Molecular Formula | C24H24N4S2 |
| Molecular Weight | 432.62 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | 3-phenyl-7-(3-phenylpyrrolidin-1-yl)-5-propyl-[1,3]thiazolo[4,5-d]pyrimidine-2-thione |
| SMILES | CCCc1nc(N2CCC(c3ccccc3)C2)c2sc(=S)n(-c3ccccc3)c2n1 |
| InChI | InChI=1S/C24H24N4S2/c1-2-9-20-25-22(27-15-14-18(16-27)17-10-5-3-6-11-17)21-23(26-20)28(24(29)30-21)19-12-7-4-8-13-19/h3-8,10-13,18H,2,9,14-16H2,1H3 |
| InChIKey | HWEHIMRBRBOCTP-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 432.62 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-phenyl-7-(3-phenylpyrrolidin-1-yl)-5-propyl-[1,3]thiazolo[4,5-d]pyrimidine-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenyl-7-(3-phenylpyrrolidin-1-yl)-5-propyl-[1,3]thiazolo[4,5-d]pyrimidine-2-thione?
The IUPAC name of 3-phenyl-7-(3-phenylpyrrolidin-1-yl)-5-propyl-[1,3]thiazolo[4,5-d]pyrimidine-2-thione (CID 3320394) is 3-phenyl-7-(3-phenylpyrrolidin-1-yl)-5-propyl-[1,3]thiazolo[4,5-d]pyrimidine-2-thione.
What is the SMILES notation for 3-phenyl-7-(3-phenylpyrrolidin-1-yl)-5-propyl-[1,3]thiazolo[4,5-d]pyrimidine-2-thione?
The canonical SMILES for 3-phenyl-7-(3-phenylpyrrolidin-1-yl)-5-propyl-[1,3]thiazolo[4,5-d]pyrimidine-2-thione is CCCc1nc(N2CCC(c3ccccc3)C2)c2sc(=S)n(-c3ccccc3)c2n1.
What is the InChIKey of 3-phenyl-7-(3-phenylpyrrolidin-1-yl)-5-propyl-[1,3]thiazolo[4,5-d]pyrimidine-2-thione?
The InChIKey is HWEHIMRBRBOCTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H24N4S2/c1-2-9-20-25-22(27-15-14-18(16-27)17-10-5-3-6-11-17)21-23(26-20)28(24(29)30-21)19-12-7-4-8-13-19/h3-8,10-13,18H,2,9,14-16H2,1H3.
What are the key properties of 3-phenyl-7-(3-phenylpyrrolidin-1-yl)-5-propyl-[1,3]thiazolo[4,5-d]pyrimidine-2-thione?
3-phenyl-7-(3-phenylpyrrolidin-1-yl)-5-propyl-[1,3]thiazolo[4,5-d]pyrimidine-2-thione has a molecular weight of 432.62 g/mol, XLogP of 6.16, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenyl-7-(3-phenylpyrrolidin-1-yl)-5-propyl-[1,3]thiazolo[4,5-d]pyrimidine-2-thione is sourced from PubChem (CID 3320394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).