C42H50F3NO3 — CID 3321716
[5-[(4-benzylpiperidin-1-yl)methyl]-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-[3-(trifluoromethyl)phenyl]methanone (PubChem CID 3321716) has the molecular formula C42H50F3NO3 and a molecular weight of 673.86 g/mol. Its IUPAC name is [5-[(4-benzylpiperidin-1-yl)methyl]-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-[3-(trifluoromethyl)phenyl]methanone.
| Compound Name | [5-[(4-benzylpiperidin-1-yl)methyl]-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-[3-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 3321716 |
| Molecular Formula | C42H50F3NO3 |
| Molecular Weight | 673.86 g/mol |
| Exact Mass | 673.37 |
| IUPAC Name | [5-[(4-benzylpiperidin-1-yl)methyl]-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-[3-(trifluoromethyl)phenyl]methanone |
| SMILES | CC12CCC(O)CC13C=CC1(C(C(=O)c4cccc(C(F)(F)F)c4)=C3)C2CCC2(C)C1CCC2(O)CN1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C42H50F3NO3/c1-37-16-11-32(47)25-39(37)19-20-41(33(26-39)36(48)30-9-6-10-31(24-30)42(43,44)45)34(37)12-17-38(2)35(41)13-18-40(38,49)27-46-21-14-29(15-22-46)23-28-7-4-3-5-8-28/h3-10,19-20,24,26,29,32,34-35,47,49H,11-18,21-23,25,27H2,1-2H3 |
| InChIKey | ZXMGHIDMHGWOOF-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.86 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|