C42H51ClFNO3 — CID 3321928
1-[5-[(4-benzylpiperidin-1-yl)methyl]-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-2-(2-chloro-6-fluorophenyl)ethanone (PubChem CID 3321928) has the molecular formula C42H51ClFNO3 and a molecular weight of 672.33 g/mol. Its IUPAC name is 1-[5-[(4-benzylpiperidin-1-yl)methyl]-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-2-(2-chloro-6-fluorophenyl)ethanone.
| Compound Name | 1-[5-[(4-benzylpiperidin-1-yl)methyl]-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-2-(2-chloro-6-fluorophenyl)ethanone |
|---|---|
| PubChem CID | 3321928 |
| Molecular Formula | C42H51ClFNO3 |
| Molecular Weight | 672.33 g/mol |
| Exact Mass | 671.35 |
| IUPAC Name | 1-[5-[(4-benzylpiperidin-1-yl)methyl]-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-2-(2-chloro-6-fluorophenyl)ethanone |
| SMILES | CC12CCC(O)CC13C=CC1(C(C(=O)Cc4c(F)cccc4Cl)=C3)C2CCC2(C)C1CCC2(O)CN1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C42H51ClFNO3/c1-38-16-11-30(46)25-40(38)19-20-42(32(26-40)35(47)24-31-33(43)9-6-10-34(31)44)36(38)12-17-39(2)37(42)13-18-41(39,48)27-45-21-14-29(15-22-45)23-28-7-4-3-5-8-28/h3-10,19-20,26,29-30,36-37,46,48H,11-18,21-25,27H2,1-2H3 |
| InChIKey | WPFZODVLNCZJGZ-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.33 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|