C40H46ClF2NO4 — CID 3321931
[5-[[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]methyl]-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-(3,4-difluorophenyl)methanone (PubChem CID 3321931) has the molecular formula C40H46ClF2NO4 and a molecular weight of 678.26 g/mol. Its IUPAC name is [5-[[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]methyl]-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-(3,4-difluorophenyl)methanone.
| Compound Name | [5-[[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]methyl]-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-(3,4-difluorophenyl)methanone |
|---|---|
| PubChem CID | 3321931 |
| Molecular Formula | C40H46ClF2NO4 |
| Molecular Weight | 678.26 g/mol |
| Exact Mass | 677.31 |
| IUPAC Name | [5-[[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]methyl]-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-(3,4-difluorophenyl)methanone |
| SMILES | CC12CCC(O)CC13C=CC1(C(C(=O)c4ccc(F)c(F)c4)=C3)C2CCC2(C)C1CCC2(O)CN1CCC(O)(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C40H46ClF2NO4/c1-35-12-9-28(45)22-37(35)15-16-40(29(23-37)34(46)25-3-8-30(42)31(43)21-25)32(35)10-13-36(2)33(40)11-14-39(36,48)24-44-19-17-38(47,18-20-44)26-4-6-27(41)7-5-26/h3-8,15-16,21,23,28,32-33,45,47-48H,9-14,17-20,22,24H2,1-2H3 |
| InChIKey | JPSJYNFTMJLMCD-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.26 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|