C14H18F3N3O3 — CID 33225106
2-methyl-N-[2-[[2-[2-oxo-3-(trifluoromethyl)-1-pyridinyl]acetyl]amino]ethyl]propanamide (PubChem CID 33225106) has the molecular formula C14H18F3N3O3 and a molecular weight of 333.31 g/mol. Its IUPAC name is 2-methyl-N-[2-[[2-[2-oxo-3-(trifluoromethyl)-1-pyridinyl]acetyl]amino]ethyl]propanamide.
| Compound Name | 2-methyl-N-[2-[[2-[2-oxo-3-(trifluoromethyl)-1-pyridinyl]acetyl]amino]ethyl]propanamide |
|---|---|
| PubChem CID | 33225106 |
| Molecular Formula | C14H18F3N3O3 |
| Molecular Weight | 333.31 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | 2-methyl-N-[2-[[2-[2-oxo-3-(trifluoromethyl)-1-pyridinyl]acetyl]amino]ethyl]propanamide |
| SMILES | CC(C)C(=O)NCCNC(=O)Cn1cccc(C(F)(F)F)c1=O |
| InChI | InChI=1S/C14H18F3N3O3/c1-9(2)12(22)19-6-5-18-11(21)8-20-7-3-4-10(13(20)23)14(15,16)17/h3-4,7,9H,5-6,8H2,1-2H3,(H,18,21)(H,19,22) |
| InChIKey | HBDALIPVSMIQFF-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.31 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|