C26H19ClN2O4 — CID 3322636
7-chloro-2-[4-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)phenyl]-8-methylquinoline-4-carboxylic acid (PubChem CID 3322636) has the molecular formula C26H19ClN2O4 and a molecular weight of 458.90 g/mol. Its IUPAC name is 7-chloro-2-[4-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)phenyl]-8-methylquinoline-4-carboxylic acid.
| Compound Name | 7-chloro-2-[4-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)phenyl]-8-methylquinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 3322636 |
| Molecular Formula | C26H19ClN2O4 |
| Molecular Weight | 458.90 g/mol |
| Exact Mass | 458.10 |
| IUPAC Name | 7-chloro-2-[4-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)phenyl]-8-methylquinoline-4-carboxylic acid |
| SMILES | Cc1c(Cl)ccc2c(C(=O)O)cc(-c3ccc(N4C(=O)C5C6C=CC(C6)C5C4=O)cc3)nc12 |
| InChI | InChI=1S/C26H19ClN2O4/c1-12-19(27)9-8-17-18(26(32)33)11-20(28-23(12)17)13-4-6-16(7-5-13)29-24(30)21-14-2-3-15(10-14)22(21)25(29)31/h2-9,11,14-15,21-22H,10H2,1H3,(H,32,33) |
| InChIKey | GELFDROQUFWAHX-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.90 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|