About N-hexadecylacetamide
N-hexadecylacetamide (PubChem CID 3322721) has the molecular formula C18H37NO
and a molecular weight of 283.50 g/mol. Its IUPAC name is N-hexadecylacetamide.
Molecular Properties
| Compound Name | N-hexadecylacetamide |
| PubChem CID | 3322721 |
| Molecular Formula | C18H37NO |
| Molecular Weight | 283.50 g/mol |
| Exact Mass | 283.29 |
| IUPAC Name | N-hexadecylacetamide |
| SMILES | CCCCCCCCCCCCCCCCNC(C)=O |
| InChI | InChI=1S/C18H37NO/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-19-18(2)20/h3-17H2,1-2H3,(H,19,20) |
| InChIKey | WZGQRPGQTOSEMN-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 283.50 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-hexadecylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-hexadecylacetamide?
The IUPAC name of N-hexadecylacetamide (CID 3322721) is N-hexadecylacetamide.
What is the SMILES notation for N-hexadecylacetamide?
The canonical SMILES for N-hexadecylacetamide is CCCCCCCCCCCCCCCCNC(C)=O.
What is the InChIKey of N-hexadecylacetamide?
The InChIKey is WZGQRPGQTOSEMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H37NO/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-19-18(2)20/h3-17H2,1-2H3,(H,19,20).
What are the key properties of N-hexadecylacetamide?
N-hexadecylacetamide has a molecular weight of 283.50 g/mol, XLogP of 5.60, 15 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-hexadecylacetamide is sourced from PubChem (CID 3322721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).