About 2-amino-7-methyl-3-nitro-4-[2-(trifluoromethyl)phenyl]-4H-pyrano[3,2-c]pyran-5-one
2-amino-7-methyl-3-nitro-4-[2-(trifluoromethyl)phenyl]-4H-pyrano[3,2-c]pyran-5-one (PubChem CID 3322783) has the molecular formula C16H11F3N2O5
and a molecular weight of 368.27 g/mol. Its IUPAC name is 2-amino-7-methyl-3-nitro-4-[2-(trifluoromethyl)phenyl]-4H-pyrano[3,2-c]pyran-5-one.
Molecular Properties
| Compound Name | 2-amino-7-methyl-3-nitro-4-[2-(trifluoromethyl)phenyl]-4H-pyrano[3,2-c]pyran-5-one |
| PubChem CID | 3322783 |
| Molecular Formula | C16H11F3N2O5 |
| Molecular Weight | 368.27 g/mol |
| Exact Mass | 368.06 |
| IUPAC Name | 2-amino-7-methyl-3-nitro-4-[2-(trifluoromethyl)phenyl]-4H-pyrano[3,2-c]pyran-5-one |
| SMILES | Cc1cc2c(c(=O)o1)C(c1ccccc1C(F)(F)F)C([N+](=O)[O-])=C(N)O2 |
| InChI | InChI=1S/C16H11F3N2O5/c1-7-6-10-12(15(22)25-7)11(13(21(23)24)14(20)26-10)8-4-2-3-5-9(8)16(17,18)19/h2-6,11H,20H2,1H3 |
| InChIKey | CEPUHMAHUUVDBQ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 108.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.27 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-7-methyl-3-nitro-4-[2-(trifluoromethyl)phenyl]-4H-pyrano[3,2-c]pyran-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-7-methyl-3-nitro-4-[2-(trifluoromethyl)phenyl]-4H-pyrano[3,2-c]pyran-5-one?
The IUPAC name of 2-amino-7-methyl-3-nitro-4-[2-(trifluoromethyl)phenyl]-4H-pyrano[3,2-c]pyran-5-one (CID 3322783) is 2-amino-7-methyl-3-nitro-4-[2-(trifluoromethyl)phenyl]-4H-pyrano[3,2-c]pyran-5-one.
What is the SMILES notation for 2-amino-7-methyl-3-nitro-4-[2-(trifluoromethyl)phenyl]-4H-pyrano[3,2-c]pyran-5-one?
The canonical SMILES for 2-amino-7-methyl-3-nitro-4-[2-(trifluoromethyl)phenyl]-4H-pyrano[3,2-c]pyran-5-one is Cc1cc2c(c(=O)o1)C(c1ccccc1C(F)(F)F)C([N+](=O)[O-])=C(N)O2.
What is the InChIKey of 2-amino-7-methyl-3-nitro-4-[2-(trifluoromethyl)phenyl]-4H-pyrano[3,2-c]pyran-5-one?
The InChIKey is CEPUHMAHUUVDBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11F3N2O5/c1-7-6-10-12(15(22)25-7)11(13(21(23)24)14(20)26-10)8-4-2-3-5-9(8)16(17,18)19/h2-6,11H,20H2,1H3.
What are the key properties of 2-amino-7-methyl-3-nitro-4-[2-(trifluoromethyl)phenyl]-4H-pyrano[3,2-c]pyran-5-one?
2-amino-7-methyl-3-nitro-4-[2-(trifluoromethyl)phenyl]-4H-pyrano[3,2-c]pyran-5-one has a molecular weight of 368.27 g/mol, XLogP of 2.90, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-7-methyl-3-nitro-4-[2-(trifluoromethyl)phenyl]-4H-pyrano[3,2-c]pyran-5-one is sourced from PubChem (CID 3322783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).